C07FACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM metal-containing porphyrins C07D487/22Attention is drawn to Note (3) C07, which defines the last place priority rule applied in the range of subclasses C07C-C07K and within these subclasses.Attention is drawn to Note (6) following the title of class C07.Attention is drawn to Note (3) after the title of section C, which Note indicates to which version of the periodic table of chemical elements the IPC refers.In this subclass , organic acid salts, alcoholates, phenates, chelates or mercaptides are classified as the parent compounds.Compounds containing Se or Te are classified with their sulfur homologuesA hydrocarbon chain is considered to be terminated by a heteroatom or by a carbon atom having three bonds to heteroatoms with at the most one to halogenWhen groups, e.g. aromatic or aliphatic groups, are mentioned without further indications, it means that the group concerned can be further substituted. Otherwise it will be indicated, e.g. C07F9/11 with hydroxyalkyl compounds without further substituents on alkyl.The following IPC groups are not in the CPC scheme. The subject matter for these IPC groups is classified in the following CPC groups: C07F9/6593 covered by C07F9/65815In this subclass non-limiting references (in the sense of paragraph 39 of the Guide to the IPC) may still be displayed in the scheme. C07F1/00 C07F1/00Compounds containing elements of Groups 1 or 11 of the Periodic System C07F1/005without C-Metal linkages C07F1/02Lithium compounds C07F1/04Sodium compounds C07F1/06Potassium compounds C07F1/08Copper compounds C07F1/10Silver compounds C07F1/12Gold compounds C07F3/00Compounds containing elements of Groups 2 or 12 of the Periodic System C07F3/003without C-Metal linkages C07F3/006Beryllium compounds C07F3/02Magnesium compounds C07F3/04Calcium compounds C07F3/06Zinc compounds C07F3/08Cadmium compounds C07F3/10Mercury compounds C07F3/103without C-Mercury linkages C07F3/12Aromatic substances containing mercury C07F3/14Heterocyclic substances containing mercury C07F5/00Compounds containing elements of Groups 3 or 13 of the Periodic System C07F5/003without C-Metal linkages C07F5/02Boron compounds C07F5/022without C-boron linkages C07F5/025Boronic and borinic acid compounds C07F5/027Organoboranes and organoborohydrides C07F5/04Esters of boric acids C07F5/05Cyclic compounds having at least one ring containing boron but no carbon in the ring C07F5/06Aluminium compounds C07F5/061with C-aluminium linkage C07F5/062Al linked exclusively to C C07F5/064compounds with an Al-Halogen linkage C07F5/065compounds with an Al-H linkage C07F5/066compounds with Al linked to an element other than Al, C, H or halogen (this includes Al-cyanide linkage) C07F5/067compounds with Al also linked to H or halogen C07F5/068preparation of alum(in)oxanes C07F5/069without C-aluminium linkages C07F7/00Compounds containing elements of Groups 4 or 14 of the Periodic System C07F7/003without C-Metal linkages C07F7/02Silicon compounds C07F7/025without C-silicon linkages C07F7/04Esters of silicic acids C07F7/06with hydroxyaryl compounds C07F7/07Cyclic esters C07F7/08Compounds having one or more C—Si linkages C07F7/0801General processes C07F7/0803Compounds with Si-C or Si-Si linkages C07F7/0805comprising only Si, C or H atoms C07F7/0807comprising Si as a ring atom C07F7/081comprising at least one atom selected from the elements N, O, halogen, S, Se or Te C07F7/0812comprising a heterocyclic ring C07F7/0814said ring is substituted at a C ring atom by Si C07F7/0816said ring comprising Si as a ring atom C07F7/0825Preparations of compounds not comprising Si-Si or Si-cyano linkages C07F7/0827Syntheses with formation of a Si-C bond C07F7/0829Hydrosilylation reactions C07F7/083Syntheses without formation of a Si-C bond C07F7/0832Other preparations C07F7/0834Compounds having one or more O-Si linkage for compounds with C-O-Si linkages see C07F7/18 C07F7/0836Compounds with one or more Si-OH or Si-O-metal linkage C07F7/0838Compounds with one or more Si-O-Si sequences compounds with a ring containing only alternating Si and O atoms, i.e. cyclosilanes C07F7/21 C07F7/087Compounds of unknown structure containing a Si-O-Si sequence C07F7/0872Preparation and treatment thereof C07F7/0874Reactions involving a bond of the Si-O-Si linkage C07F7/0876Reactions involving the formation of bonds to a Si atom of a Si-O-Si sequence other than a bond of the Si-O-Si linkage C07F7/0878Si-C bond C07F7/0879Hydrosilylation reactions C07F7/0889Reactions not involving the Si atom of the Si-O-Si sequence C07F7/089Treatments not covered by a preceding group C07F7/0892Compounds with a Si-O-N linkage C07F7/0894Compounds with a Si-O-O linkage C07F7/0896Compounds with a Si-H linkage C07F7/0898Compounds with a Si-S linkage C07F7/10containing nitrogen having a Si-N linkage C07F7/12Organo silicon halides C07F7/121Preparation or treatment not provided for in C07F7/14, C07F7/16 or C07F7/20The silicon atom involved in the reaction that is attached or becomes attached to the highest number of halide atoms determines classification C07F7/122by reactions involving the formation of Si-C linkages hydrosilylation reactions C07F7/14; direct synthesis C07F7/16 C07F7/123by reactions involving the formation of Si-halogen linkages C07F7/125by reactions involving both Si-C and Si-halogen linkages, the Si-C and Si-halogen linkages can be to the same or to different Si atoms, e.g. redistribution reactions C07F7/126by reactions involving the formation of Si-Y linkages, where Y is not a carbon or halogen atom C07F7/127by reactions not affecting the linkages to the silicon atom C07F7/128by reactions covered by more than one of the groups C07F7/122 - C07F7/127 and of which the starting material is unknown or insufficiently determined C07F7/14Preparation thereof from optionally substituted halogenated silanes and hydrocarbons hydrosilylation reactions C07F7/16Preparation thereof from silicon and halogenated hydrocarbons direct synthesis C07F7/18Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages C07F7/1804Compounds having Si-O-C linkages Si-O-acyl linkages C07F7/1896 C07F7/1872Preparation; Treatments not provided for in C07F7/20 C07F7/1876by reactions involving the formation of Si-C linkages C07F7/188by reactions involving the formation of Si-O linkages C07F7/1884by dismutation C07F7/1888by reactions involving the formation of other Si-linkages, e.g. Si-N C07F7/1892by reactions not provided for in C07F7/1876 - C07F7/1888 C07F7/1896Compounds having one or more Si-O-acyl linkages C07F7/20Purification, separation C07F7/21Cyclic compounds having at least one ring containing silicon, but no carbon in the ring C07F7/22Tin compounds C07F7/2204Not belonging to the groups C07F7/2208 - C07F7/2296 C07F7/2208Compounds having tin linked only to carbon, hydrogen and/or halogen C07F7/2224Compounds having one or more tin-oxygen linkages C07F7/226Compounds with one or more Sn-S linkages C07F7/2284Compounds with one or more Sn-N linkages C07F7/2288Compounds with one or more Sn-metal linkages C07F7/2296Purification, stabilisation, isolation C07F7/24Lead compounds C07F7/26Tetra-alkyl lead compounds C07F7/28Titanium compounds C07F7/30Germanium compounds C07F9/00Compounds containing elements of Groups 5 or 15 of the Periodic System C07F9/005Compounds of elements of Group 5 of the Periodic System without metal-carbon linkages C07F9/02Phosphorus compounds sugar phosphates C07H11/04; nucleotides C07H19/00, C07H21/00; nucleic acids C07H21/00 C07F9/025Purification; Separation; Stabilisation; Desodorisation of organo-phosphorus compounds of natural phosphatides C07F9/103; phosphines C07F9/5095 C07F9/04Reaction products of phosphorus sulfur compounds with hydrocarbons C07F9/06without P—C bonds C07F9/062Organo-phosphoranes without P-C bonds C07F9/065Phosphoranes containing the structure P=N- C07F9/067Polyphosphazenes containing the structure [P=N-n] cyclic compounds C07F9/65812 C07F9/08Esters of oxyacids of phosphorus C07F9/062 takes precedence C07F9/09Esters of phosphoric acids C07F9/091with hydroxyalkyl compounds with further substituents on alkyl C07F9/092substituted by B, Si or a metal C07F9/093Polyol derivatives esterified at least twice by phosphoric acid groups C07F9/094with arylalkanols C07F9/095Compounds containing the structure P(=O)-O-acyl, P(=O)-O-heteroatom, P(=O)-O-CN C07F9/096Compounds containing the structure P(=O)-O-C(=X)- (X = O, S, Se) C07F9/097Compounds containing the structure P(=O)-O-N C07F9/098Esters of polyphosphoric acids or anhydrides C07F9/10Phosphatides, e.g. lecithin C07F9/103Extraction or purification by physical or chemical treatment of natural phosphatides; Preparation of compositions containing phosphatides of unknown structure C07F9/106Adducts, complexes, salts of phosphatides C07F9/11with hydroxyalkyl compounds without further substituents on alkyl C07F9/113with unsaturated acyclic alcohols C07F9/117with cycloaliphatic alcohols C07F9/12with hydroxyaryl compounds C07F9/14containing P(=O)-halide groups C07F9/1403containing the structure Hal-P(=O)-O-unsaturated acyclic group C07F9/1406containing the structure Hal-P(=O)-O-aryl C07F9/141Esters of phosphorous acids C07F9/1411with hydroxyalkyl compounds with further substituents on alkyl C07F9/1412Polyol derivatives esterified at least twice by phosphorous acid groups C07F9/1414with arylalkanols C07F9/1415Compounds containing the structure P-O-acyl, P-O-heteroatom, P-O-CN C07F9/1417Compounds containing the structure P-O-C(=X)- (X = O, S, Se) C07F9/1418Compounds containing the structure P-O-N C07F9/142with hydroxyalkyl compounds without further substituents on alkyl C07F9/143with unsaturated acyclic alcohols C07F9/144with cycloaliphatic alcohols C07F9/145with hydroxyaryl compounds C07F9/146containing P-halide groups C07F9/16Esters of thiophosphoric acids or thiophosphorous acids C07F9/165Esters of thiophosphoric acids C07F9/1651with hydroxyalkyl compounds with further substituents on alkyl C07F9/1652Polyol derivatives esterified at least twice by thiophosphoric acid groups C07F9/1653with arylalkanols C07F9/1654Compounds containing the structure P(=X)n-X-acyl, P(=X)n-X-heteroatom, P(=X)n-X-CN (X = O, S, Se; n = 0, 1) C07F9/1655Compounds containing the structure P(=X)n-S-(S)x- (X = O, S, Se; n=0,1; x>=1) C07F9/1656Compounds containing the structure P(=X)n-X-C(=X)- (X = O, S, Se; n = 0, 1) C07F9/1657Compounds containing the structure P(=X)n-X-N (X = O, S, Se; n = 0, 1) C07F9/1658Esters of thiopolyphosphoric acids or anhydrides C07F9/17with hydroxyalkyl compounds without further substituents on alkyl C07F9/173with unsaturated acyclic alcohols C07F9/177with cycloaliphatic alcohols C07F9/18with hydroxyaryl compounds C07F9/20containing P-halide groups C07F9/2003containing the structure Hal-P-X-unsaturated acyclic group C07F9/2006containing the structure Hal-P-X-aryl C07F9/201Esters of thiophosphorus acids C07F9/2015with hydroxyalkyl compounds with further substituents on alkyl C07F9/202with hydroxyl compounds without further substituents on alkyl C07F9/203with unsaturated acyclic alcohols C07F9/204with cycloaliphatic alcohols C07F9/205with hydroxyaryl compounds C07F9/206containing P-halide groups C07F9/22Amides of acids of phosphorus C07F9/222Amides of phosphoric acids C07F9/224Phosphorus triamides C07F9/226containing the structure P-isocyanates C07F9/228containing the structure P-N-N, e.g. azides, hydrazides C07F9/24Esteramides C07F9/2404the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/2408of hydroxyalkyl compounds C07F9/2412of unsaturated acyclic alcohols C07F9/2416of cycloaliphatic alcohols C07F9/242of hydroxyaryl compounds C07F9/2425containing the structure (RX)(RR'N)P(=Y)-Z-(C)n-Z'-P(=Y)(XR)2 (X = O, S, NR; Y = O, S, electron pair; Z = O, S; Z' = O, S) C07F9/2429of arylalkanols C07F9/2433Compounds containing the structure N-P(=X)n-X-acyl, N-P(=X)n-X-heteroatom, N-P(=X)n-X-CN (X = O, S, Se; n = 0, 1) C07F9/2437Compounds containing the structure N-P(=X)n-S-(S)x-(X = O, S, Se; n=0,1; x>=1) C07F9/2441containing the structure N-P(=X)n-X-C(=X) (X = O, S, Se; n = 0, 1) C07F9/2445containing the structure N-P(=X)n-X-N (X = O, S, Se; n = 0, 1) C07F9/245containing the structure N-P(=X)n-X-P (X = O, S, Se; n = 0, 1) C07F9/2454the amide moiety containing a substituent or a structure which is considered as characteristic C07F9/2458of aliphatic amines C07F9/2462of unsaturated acyclic amines C07F9/2466of cycloaliphatic amines C07F9/247of aromatic amines (N-C aromatic linkage) C07F9/2475of aralkylamines C07F9/2479Compounds containing the structure P(=X)n-N-acyl, P(=X)n-N-heteroatom, P(=X)n-N-CN (X = O, S, Se; n = 0, 1) C07F9/2483containing the structure P(=X)n-N-S (X = O, S, Se; n = 0, 1) C07F9/2487containing the structure P(=X)n-N-C(=X) (X = O, S, Se; n = 0, 1) C07F9/2491containing the structure P(=X)n-N-N (X = O, S, Se; n = 0, 1) C07F9/2495containing the structure P(=X)n-N-P (X = O, S, Se; n = 0, 1) C07F9/26containing P-halide groups C07F9/28with one or more P—C bonds C07F9/30Phosphinic acids R₂P(=O)(OH)Thiophosphinic acids , i.e. R₂P(=X)(XH) (X = S, Se) C07F9/301Acyclic saturated acids which can have further substituents on alkyl C07F9/302Acyclic unsaturated acids C07F9/303Cycloaliphatic acids C07F9/304Aromatic acids (P-C aromatic linkage) C07F9/305Poly(thio)phosphinic acids C07F9/306Arylalkanephosphinic acids, e.g. Ar-(CH2)n-P(=X)(R)(XH), (X = O,S, Se; n>=1) C07F9/307Acids containing the structure -C(=X)-P(=X)(R)(XH) or NC-P(=X)(R)(XH), (X = O, S, Se) C07F9/308Pyrophosphinic acids; Phosphinic acid anhydrides C07F9/32Esters thereof C07F9/3205the acid moiety containing a substituent or a structure which is considered as characteristic C07F9/3211Esters of acyclic saturated acids which can have further substituents on alkyl C07F9/3217Esters of acyclic unsaturated acids C07F9/3223Esters of cycloaliphatic acids C07F9/3229Esters of aromatic acids (P-C aromatic linkage) C07F9/3235Esters of poly(thio)phosphinic acids C07F9/3241Esters of arylalkanephosphinic acids C07F9/3247Esters of acids containing the structure -C(=X)-P(=X)(R)(XH) or NC-P(=X)(R)(XH), (X = O, S, Se) C07F9/3252containing the structure -C(=X)-P(=X)(R)(XR), (X = O, S, Se) C07F9/3258the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/3264Esters with hydroxyalkyl compounds C07F9/327Esters with unsaturated acyclic alcohols C07F9/3276Esters with cycloaliphatic alcohols C07F9/3282Esters with hydroxyaryl compounds C07F9/3288Esters with arylalkanols C07F9/3294Compounds containing the structure R2P(=X)-X-acyl, R2P(=X)-X-heteroatom, R2P(=X)-X-CN (X = O, S, Se) C07F9/34Halides thereof C07F9/36Amides thereof C07F9/38Phosphonic acids RP(=O)(OH)₂Thiophosphonic acids , i.e. RP(=X)(XH)2 (X = S, Se) C07F9/3804not used, see subgroups C07F9/3808Acyclic saturated acids which can have further substituents on alkyl C07F9/3813N-Phosphonomethylglycine; Salts or complexes thereof C07F9/3817Acids containing the structure (RX)2P(=X)-alk-N...P (X = O, S, Se) C07F9/3821substituted by B, Si, P or a metal C07F9/3839 takes precedence C07F9/3826Acyclic unsaturated acids C07F9/383Cycloaliphatic acids C07F9/3834Aromatic acids (P-C aromatic linkage) C07F9/3839Polyphosphonic acids C07F9/3843containing no further substituents than -PO₃H₂ groups C07F9/3847Acyclic unsaturated derivatives C07F9/3852Cycloaliphatic derivatives C07F9/3856containing halogen or nitro(so) substituents C07F9/386containing hydroxy substituents in the hydrocarbon radicals C07F9/3865containing sulfur substituents C07F9/3869containing carboxylic acid or carboxylic acid derivative substituents C07F9/3873containing nitrogen substituent, e.g. N.....H or N-hydrocarbon group which can be substituted by halogen or nitro(so), N.....O, N.....S, N.....C(=X)- (X =O, S), N.....N, N...C(=X)...N (X =O, S) C07F9/3878containing substituents selected from B, Si, P (other than -PO₃H₂ groups) or a metal C07F9/3882Arylalkanephosphonic acids C07F9/3839 takes precedence C07F9/3886Acids containing the structure -C(=X)-P(=X)(XH)2 or NC-P(=X)(XH)2, (X = O, S, Se) C07F9/3891Acids containing the structure -C(=X)-P(=X)(XH)2, (X = O, S, Se) C07F9/3895Pyrophosphonic acids; phosphonic acid anhydrides C07F9/40Esters thereof C07F9/4003the acid moiety containing a substituent or a structure which is considered as characteristic C07F9/4006Esters of acyclic acids which can have further substituents on alkyl C07F9/4009Esters containing the structure (RX)2P(=X)-alk-N...P (X = O, S, Se) C07F9/4012substituted by B, Si, P or a metal C07F9/4025 takes precedence C07F9/4015Esters of acyclic unsaturated acids C07F9/4018Esters of cycloaliphatic acids C07F9/4021Esters of aromatic acids (P-C aromatic linkage) C07F9/4025Esters of poly(thio)phosphonic acids C07F9/4028containing no further substituents than -PO₃H₂ groups in free or esterified form C07F9/4031Acyclic unsaturated derivatives C07F9/4034Cycloaliphatic derivatives C07F9/4037containing halogen or nitro(so) substituents C07F9/404containing hydroxy substituents in the hydrocarbon radicals C07F9/4043containing sulfur substituents C07F9/4046containing carboxylic acid or carboxylic acid derivative substituents C07F9/405containing nitrogen substituent, e.g. N.....H or N-hydrocarbon group which can be substituted by halogen or nitro(so), N.....O, N.....S, N.....C(=X)- (X =O, S), N.....N, N...C(=X)...N (X =O, S) C07F9/4053containing substituents selected from B, Si, P (other than -PO₃H₂ groups in free or esterified form), or a metal C07F9/4056Esters of arylalkanephosphonic acids C07F9/4025 takes precedence C07F9/4059Compounds containing the structure (RY)2P(=X)-(CH₂)n-C(=O)-(CH₂)m-Ar, (X, Y = O, S, Se; n>=1, m>=0) C07F9/4062Esters of acids containing the structure -C(=X)-P(=X)(XR)2 or NC-P(=X)(XR)2, (X = O, S, Se) C07F9/4065Esters of acids containing the structure -C(=X)-P(=X)(XR)2, (X = O, S, Se) C07F9/4068Esters of pyrophosphonic acids; Esters of phosphonic acid anhydrides C07F9/4071the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/4075Esters with hydroxyalkyl compounds C07F9/4078Esters with unsaturated acyclic alcohols C07F9/4081Esters with cycloaliphatic alcohols C07F9/4084Esters with hydroxyaryl compounds C07F9/4087Esters with arylalkanols C07F9/409Compounds containing the structure P(=X)-X-acyl, P(=X) -X-heteroatom, P(=X)-X-CN (X = O, S, Se) C07F9/4093Compounds containing the structure P(=X)-X-C(=X)- (X = O, S, Se) C07F9/4096Compounds containing the structure P(=X)-X-N (X = O, S, Se) C07F9/42Halides thereof C07F9/425Acid or estermonohalides thereof, e.g. RP(=X)(YR)(Hal) (X, Y = O, S; R = H, or hydrocarbon group) C07F9/44Amides thereof C07F9/4403the acid moiety containing a substituent or a structure which is considered as characteristic C07F9/4407Amides of acyclic saturated acids which can have further substituents on alkyl C07F9/4411Amides of acyclic unsaturated acids C07F9/4415Amides of cycloaliphatic acids C07F9/4419Amides of aromatic acids (P-C aromatic linkage) C07F9/4423Amides of poly (thio)phosphonic acids C07F9/4426Amides of arylalkanephosphonic acids C07F9/443Amides of acids containing the structure -C(=Y)-P(=X)(XR)-N or NC-(P(=X)(XR)-N ) C07F9/4434the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/4438Ester with hydroxyalkyl compounds C07F9/4442Esters with unsaturated acyclic alcohols C07F9/4446Esters with cycloaliphatic alcohols C07F9/4449Esters with hydroxyaryl compounds C07F9/4453Esters with arylalkanols C07F9/4457Compounds containing the structure C-P(=X)(X-acyl)-N, C-P(=X)(X-heteroatom)-N or C-P(=X)(X-CN)-N (X, Y = O, S) C07F9/4461the amide moiety containing a substituent or a structure which is considered as characteristic C07F9/4465of aliphatic amines C07F9/4469of unsaturated acyclic amines C07F9/4473of cycloaliphatic amines C07F9/4476of aromatic amines (N-C aromatic linkage) C07F9/448of aralkylamines C07F9/4484Compounds containing the structure C-P(=X)(N-acyl)-X, C-P(=X)(N-heteroatom)-X or C-P(=X)(N-CN)-X (X = O, S, Se) C07F9/4488Compounds containing the structure P(=X)(N-S-) (X = O, S, Se) C07F9/4492Compounds containing the structure P(=X)(N-C(=X)-) (X = O, S, Se) C07F9/4496Compounds containing the structure P(=X)(N-N-) (X = O, S, Se) C07F9/46Phosphinous acids R₂=P—OHThiophosphinous acidsAminophosphines R₂-P-NH₂ including R₂P(=O)H; derivatives thereof C07F9/48Phosphonous acids R—P(OH)₂Thiophosphonous acids including RHP(=O)(OH); Derivatives thereof C07F9/4808the acid moiety containing a substituent or structure which is considered as characteristic C07F9/4816Acyclic saturated acids or derivatices which can have further substituents on alkyl C07F9/4825Acyclic unsaturated acids or derivatives C07F9/4833Cycloaliphatic acids or derivatives C07F9/4841Aromatic acids or derivatives (P-C aromatic linkage) C07F9/485Polyphosphonous acids or derivatives C07F9/4858Acids or derivatives containing the structure -C(=X)-P(XR)2 or NC-P(XR)2 (X = O, S, Se) C07F9/4866the ester moiety containing a substituent or structure which is considered as characteristic C07F9/4875Esters with hydroxy aryl compounds C07F9/4883Amides or esteramides thereof, e.g. RP(NR'2)2 or RP(XR')(NR''2) (X = O, S) C07F9/4891Monohalide derivatives RP (XR') (Hal) (X = O, S, N) dihalide derivatives C07F9/52 C07F9/50Organo-phosphines C07F9/5004Acyclic saturated phosphines C07F9/5009substituted by B, Si, P or a metal C07F9/5027 takes precedence C07F9/5013Acyclic unsaturated phosphines C07F9/5018Cycloaliphatic phosphines C07F9/5022Aromatic phosphines (P-C aromatic linkage) C07F9/5027Polyphosphines C07F9/5031Arylalkane phosphines C07F9/5027 takes precedence C07F9/5036Phosphines containing the structure -C(=X)-P or NC-P C07F9/504Organo-phosphines containing a P-P bond C07F9/5045Complexes or chelates of phosphines with metallic compounds or metals C07F9/505Preparation; Separation; Purification; Stabilisation C07F9/5054by a process in which the phosphorus atom is not involved C07F9/5059by addition of phosphorus compounds to alkenes or alkynes C07F9/5063from compounds having the structure P-H or P-Heteroatom, in which one or more of such bonds are converted into P-C bonds C07F9/5059 takes precedence C07F9/5068from starting materials having the structure >P-Hal C07F9/5072from starting materials having the structure P-H C07F9/5059 takes precedence C07F9/5077from starting materials having the structure P-Metal, including R₂P^-M⁺ C07F9/5081from starting materials having the structure >P-Het, Het being an heteroatom different from Hal or Metal C07F9/5086from phosphonium salts as starting materials C07F9/509by reduction of pentavalent phosphorus derivatives, e.g. -P=X with X = O, S, Se or -P-Hal2 C07F9/5095Separation; Purification; Stabilisation C07F9/52Halophosphines C07F9/53Organo-phosphine oxidesOrgano-phosphine thioxides C07F9/5304Acyclic saturated phosphine oxides or thioxides C07F9/5308substituted by B, Si, P or a metal C07F9/5312substituted by a phosphorus atom C07F9/5329 takes precedence C07F9/5316Unsaturated acyclic phosphine oxides or thioxides C07F9/532Cycloaliphatic phosphine oxides or thioxides C07F9/5325Aromatic phosphine oxides or thioxides (P-C aromatic linkage) C07F9/5329Polyphosphine oxides or thioxides C07F9/5333Arylalkane phosphine oxides or thioxides C07F9/5329 takes precedence C07F9/5337Phosphine oxides or thioxides containing the structure -C(=X)-P(=X) or NC-P(=X) (X = O, S, Se) C07F9/5341Organo-phosphine oxides or thioxides containing a P-P bond C07F9/5345Complexes or chelates of phosphine-oxides or thioxides with metallic compounds or metals C07F9/535Organo-phosphoranes C07F9/5352Phosphoranes containing the structure P=C- C07F9/5355Phosphoranes containing the structure P=N- C07F9/5357Polyphosphazenes containing the structure [P=N-]n cyclic phosphazenes C07F9/65812 C07F9/54Quaternary phosphonium compounds C07F9/5407Acyclic saturated phosphonium compounds C07F9/5414substituted by B, Si, P or a metal C07F9/5421substituted by a phosphorus atom C07F9/5449 takes precedence C07F9/5428Acyclic unsaturated phosphonium compounds C07F9/5435Cycloaliphatic phosphonium compounds C07F9/5442Aromatic phosphonium compounds (P-C aromatic linkage) C07F9/5449Polyphosphonium compounds C07F9/5456Arylalkanephosphonium compounds C07F9/5463Compounds of the type "quasi-phosphonium", e.g. (C)a-P-(Y)b wherein a+b=4, b>=1 and Y=heteroatom, generally N or O C07F9/547Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom C07F9/5475having nitrogen and selenium with or without oxygen or sulfur as ring hetero atoms; having nitrogen and tellurium with or without oxygen or sulfur as ring hetero atoms C07F9/553having one nitrogen atom as the only ring hetero atom C07F9/5532Seven-(or more) membered rings C07F9/5535condensed with carbocyclic rings or ring systems C07F9/5537the heteroring containing the structure -C(=O)-N-C(=O)- (both carbon atoms belong to the heteroring) C07F9/564Three-membered rings C07F9/568Four-membered rings C07F9/5686condensed with carbocyclic rings or ring systems C07F9/572Five-membered rings C07F9/5728condensed with carbocyclic rings or carbocyclic ring systems C07F9/576Six-membered rings C07F9/5765condensed with carbocyclic rings or carbocyclic ring systems C07F9/58Pyridine rings C07F9/59Hydrogenated pyridine rings C07F9/60Quinoline or hydrogenated quinoline ring systems C07F9/62Isoquinoline or hydrogenated isoquinoline ring systems C07F9/64Acridine or hydrogenated acridine ring systems C07F9/645having two nitrogen atoms as the only ring hetero atoms C07F9/6503Five-membered rings C07F9/65031having the nitrogen atoms in the positions 1 and 2 C07F9/65038condensed with carbocyclic rings or carbocyclic ring systems C07F9/6506having the nitrogen atoms in positions 1 and 3 C07F9/65068condensed with carbocyclic rings or carbocyclic ring systems C07F9/6509Six-membered rings C07F9/650905having the nitrogen atoms in the positions 1 and 2 C07F9/650947condensed with carbocyclic rings or carbocyclic ring systems C07F9/650952having the nitrogen atoms in the positions 1 and 4 C07F9/650994condensed with carbocyclic rings or carbocyclic ring systems C07F9/6512having the nitrogen atoms in positions 1 and 3 C07F9/65128condensed with carbocyclic rings or carbocyclic ring systems C07F9/6515having three nitrogen atoms as the only ring hetero atoms C07F9/6518Five-membered rings C07F9/65188condensed with carbocyclic rings or carbocyclic ring systems C07F9/6521Six-membered rings C07F9/65218condensed with carbocyclic rings or carbocyclic ring systems C07F9/6524having four or more nitrogen atoms as the only ring hetero atoms C07F9/6527having nitrogen and oxygen atoms as the only ring hetero atoms C07F9/653Five-membered rings C07F9/65306containing two nitrogen atoms C07F9/65312having the two nitrogen atoms in positions 1 and 2 C07F9/65318having the two nitrogen atoms in positions 1 and 3 C07F9/65324condensed with carbocyclic rings or carbocyclic ring systems C07F9/6533Six-membered rings C07F9/65335condensed with carbocyclic rings or carbocyclic ring systems C07F9/6536having nitrogen and sulfur atoms with or without oxygen atoms, as the only ring hetero atoms C07F9/6539Five-membered rings C07F9/65392containing two nitrogen atoms C07F9/65395having the two nitrogen atoms in positions 1 and 2 C07F9/65397having the two nitrogen atoms in positions 1 and 3 C07F9/6541condensed with carbocyclic rings or carbocyclic ring systems C07F9/6544Six-membered rings C07F9/6547condensed with carbocyclic rings or carbocyclic ring systems C07F9/655having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms C07F9/65502the oxygen atom being part of a three-membered ring C07F9/65505Phosphonic acids containing oxirane groups; esters thereof C07F9/65507condensed with carbocyclic rings or carbocyclic ring systems C07F9/6551the oxygen atom being part of a four-membered ring C07F9/65512condensed with carbocyclic rings or carbocyclic ring systems C07F9/65515the oxygen atom being part of a five-membered ring C07F9/65517condensed with carbocyclic rings or carbocyclic ring systems C07F9/6552the oxygen atom being part of a six-membered ring C07F9/65522condensed with carbocyclic rings or carbocyclic ring systems C07F9/65525the oxygen atom being part of a seven-(or more) membered ring C07F9/65527condensed with carbocyclic rings or carbocyclic ring systems C07F9/6553having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms C07F9/655309the sulfur atom being part of a three-membered ring C07F9/655318condensed with carbocyclic rings or carbocyclic ring systems C07F9/655327the sulfur atom being part of a four-membered ring C07F9/655336condensed with carbocyclic rings or carbocyclic ring systems C07F9/655345the sulfur atom being part of a five-membered ring C07F9/655354condensed with carbocyclic rings or carbocyclic ring systems C07F9/655363the sulfur atom being part of a six-membered ring C07F9/655372condensed with carbocyclic rings or carbocyclic ring systems C07F9/655381the sulfur atom being part of a seven-(or more) membered ring C07F9/65539condensed with carbocyclic rings or carbocyclic ring systems C07F9/6558containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system C07F9/65583each of the hetero rings containing nitrogen as ring hetero atom C07F9/65586at least one of the hetero rings does not contain nitrogen as ring hetero atom C07F9/6561containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings C07F9/65611containing the ring system (X = CH₂, O, S, NH) optionally with an additional double bond and/or substituents, e.g. penicillins and analogs C07F9/65613containing the ring system (X = CH₂, O, S, NH) optionally with an additional double bond and/or substituents, e.g. cephalosporins and analogs C07F9/65615containing a spiro condensed ring system of the formula where at least one of the atoms X or Y is a hetero atom, e.g. S C07F9/65616containing the ring system having three or more than three double bonds between ring members or between ring members and non-ring members, e.g. purine or analogs C07F9/65618containing the ring system, e.g. flavins or analogues C07F9/6564having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms C07F9/6568having phosphorus atoms as the only ring hetero atoms C07F9/65681the ring phosphorus atom being part of a (thio)phosphinic acid or ester thereof C07F9/65683the ring phosphorus atom being part of a phosphine C07F9/65685the ring phosphorus atom being part of a phosphine oxide or thioxide C07F9/65686the ring phosphorus atom being part of an organo-phosphorane C07F9/65688the ring phosphorus atom being part of a phosphonium compound C07F9/6571having phosphorus and oxygen atoms as the only ring hetero atoms C07F9/657109esters of oxyacids of phosphorus in which one or more exocyclic oxygen atoms have been replaced by (a) sulfur atom(s) C07F9/657118non-condensed with carbocyclic rings or heterocyclic rings or ring systems C07F9/657127condensed with carbocyclic or heterocyclic rings or ring systems C07F9/657136the molecule containing more than one cyclic phosphorus atom C07F9/657145the cyclic phosphorus atom belonging to more than one ring system C07F9/657154Cyclic esteramides of oxyacids of phosphorus C07F9/657163the ring phosphorus atom being bound to at least one carbon atom C07F9/657172the ring phosphorus atom and one oxygen atom being part of a (thio)phosphinic acid ester: (X = O, S) C07F9/657181the ring phosphorus atom and, at least, one ring oxygen atom being part of a (thio)phosphonic acid derivative C07F9/65719the ring phosphorus atom and, at least, one ring oxygen atom being part of a (thio)phosphonous acid derivative C07F9/6574Esters of oxyacids of phosphorus C07F9/657163 takes precedence C07F9/65742non-condensed with carbocyclic rings or heterocyclic rings or ring systems C07F9/65744condensed with carbocyclic or heterocyclic rings or ring systems C07F9/65746the molecule containing more than one cyclic phosphorus atom C07F9/65748the cyclic phosphorus atom belonging to more than one ring system C07F9/6578having phosphorus and sulfur atoms with or without oxygen atoms, as ring hetero atoms C07F9/65785the ring phosphorus atom and, at least, one ring sulfur atom being part of a thiophosphonic acid derivative C07F9/6581having phosphorus and nitrogen atoms with or without oxygen or sulfur atoms, as ring hetero atoms C07F9/65811having four or more phosphorus atoms as ring hetero atoms C07F9/65812Cyclic phosphazenes [P=N-]n, n>=3 C07F9/65814n = 3 or 4 C07F9/65815n = 3 C07F9/65817n = 4 C07F9/65818n > 4 C07F9/6584having one phosphorus atom as ring hetero atom C07F9/65842Cyclic amide derivatives of acids of phosphorus, in which one nitrogen atom belongs to the ring C07F9/65844the phosphorus atom being part of a five-membered ring which may be condensed with another ring system C07F9/65846the phosphorus atom being part of a six-membered ring which may be condensed with another ring system C07F9/65848Cyclic amide derivatives of acids of phosphorus, in which two nitrogen atoms belong to the ring C07F9/6587having two phosphorus atoms as ring hetero atoms in the same ring C07F9/659having three phosphorus atoms as ring hetero atoms in the same ring C07F9/65812 takes precedence C07F9/6596having atoms other than oxygen, sulfur, selenium, tellurium, nitrogen or phosphorus as ring hetero atoms C07F9/66Arsenic compounds C07F9/68without As—C bonds C07F9/70Organo-arsenic compounds C07F9/72Aliphatic compounds C07F9/74Aromatic compounds C07F9/76containing hydroxyl groups C07F9/78containing amino groups C07F9/80Heterocyclic compounds C07F9/82Arsenic compounds containing one or more pyridine rings C07F9/84Arsenic compounds containing one or more quinoline ring systems C07F9/86Arsenic compounds containing one or more isoquinoline ring systems C07F9/88Arsenic compounds containing one or more acridine ring systems C07F9/90Antimony compounds C07F9/902Compounds without antimony-carbon linkages C07F9/92Aromatic compounds C07F9/94Bismuth compounds C07F11/00Compounds containing elements of Groups 6 or 16 of the Periodic System C07F11/005compounds without a metal-carbon linkage C07F13/00Compounds containing elements of Groups 7 or 17 of the Periodic System C07F13/005Compounds without a metal-carbon linkage C07F15/00Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic System C07F15/0006compounds of the platinum group C07F15/0013without a metal-carbon linkage C07F15/002Osmium compounds C07F15/0026without a metal-carbon linkage C07F15/0033Iridium compounds C07F15/004without a metal-carbon linkage C07F15/0046Ruthenium compounds C07F15/0053without a metal-carbon linkage C07F15/006Palladium compounds C07F15/0066without a metal-carbon linkage C07F15/0073Rhodium compounds C07F15/008without a metal-carbon linkage C07F15/0086Platinum compounds C07F15/0093without a metal-carbon linkage C07F15/02Iron compounds C07F15/025without a metal-carbon linkage C07F15/03SideraminesThe corresponding desferri compounds C07F15/04Nickel compounds C07F15/045without a metal-carbon linkage C07F15/06Cobalt compounds C07F15/065without a metal-carbon linkage C07F17/00Metallocenes C07F17/02of metals of Groups 8, 9 or 10 of the Periodic System C07F19/00Metal compounds according to more than one of main groups C07F1/00 - C07F17/00 C07F19/005without metal-C linkages